C9H18ClNO5S2 — CID 115339060
N-(4-chloro-1,1-dioxothiolan-3-yl)-2-propan-2-yloxyethanesulfonamide (PubChem CID 115339060) has the molecular formula C9H18ClNO5S2 and a molecular weight of 319.83 g/mol. Its IUPAC name is N-(4-chloro-1,1-dioxothiolan-3-yl)-2-propan-2-yloxyethanesulfonamide.
| Compound Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-2-propan-2-yloxyethanesulfonamide |
|---|---|
| PubChem CID | 115339060 |
| Molecular Formula | C9H18ClNO5S2 |
| Molecular Weight | 319.83 g/mol |
| Exact Mass | 319.03 |
| IUPAC Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-2-propan-2-yloxyethanesulfonamide |
| SMILES | CC(C)OCCS(=O)(=O)NC1CS(=O)(=O)CC1Cl |
| InChI | InChI=1S/C9H18ClNO5S2/c1-7(2)16-3-4-18(14,15)11-9-6-17(12,13)5-8(9)10/h7-9,11H,3-6H2,1-2H3 |
| InChIKey | FVYXMFSWUYSWKP-UHFFFAOYSA-N |
| XLogP | -0.26 |
| TPSA | 89.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.83 |
| LogP ≤ 5 | -0.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|