C8H16ClNO4S2 — CID 115339043
N-(4-chloro-1,1-dioxothiolan-3-yl)butane-1-sulfonamide (PubChem CID 115339043) has the molecular formula C8H16ClNO4S2 and a molecular weight of 289.81 g/mol. Its IUPAC name is N-(4-chloro-1,1-dioxothiolan-3-yl)butane-1-sulfonamide.
| Compound Name | N-(4-chloro-1,1-dioxothiolan-3-yl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 115339043 |
| Molecular Formula | C8H16ClNO4S2 |
| Molecular Weight | 289.81 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | N-(4-chloro-1,1-dioxothiolan-3-yl)butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NC1CS(=O)(=O)CC1Cl |
| InChI | InChI=1S/C8H16ClNO4S2/c1-2-3-4-16(13,14)10-8-6-15(11,12)5-7(8)9/h7-8,10H,2-6H2,1H3 |
| InChIKey | BDJPSGSPQAZENW-UHFFFAOYSA-N |
| XLogP | 0.11 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.81 |
| LogP ≤ 5 | 0.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|