C10H20ClNO2S — CID 114632207
N-(3-chloro-2,2-dimethylcyclobutyl)butane-1-sulfonamide (PubChem CID 114632207) has the molecular formula C10H20ClNO2S and a molecular weight of 253.79 g/mol. Its IUPAC name is N-(3-chloro-2,2-dimethylcyclobutyl)butane-1-sulfonamide.
| Compound Name | N-(3-chloro-2,2-dimethylcyclobutyl)butane-1-sulfonamide |
|---|---|
| PubChem CID | 114632207 |
| Molecular Formula | C10H20ClNO2S |
| Molecular Weight | 253.79 g/mol |
| Exact Mass | 253.09 |
| IUPAC Name | N-(3-chloro-2,2-dimethylcyclobutyl)butane-1-sulfonamide |
| SMILES | CCCCS(=O)(=O)NC1CC(Cl)C1(C)C |
| InChI | InChI=1S/C10H20ClNO2S/c1-4-5-6-15(13,14)12-9-7-8(11)10(9,2)3/h8-9,12H,4-7H2,1-3H3 |
| InChIKey | CCVJJODFMWKIQW-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.79 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|