C12H15ClFNO4S2 — CID 107328222
N-(4-chloro-1,1-dioxothiolan-3-yl)-4-fluoro-2,6-dimethylbenzenesulfonamide (PubChem CID 107328222) has the molecular formula C12H15ClFNO4S2 and a molecular weight of 355.84 g/mol. Its IUPAC name is N-(4-chloro-1,1-dioxothiolan-3-yl)-4-fluoro-2,6-dimethylbenzenesulfonamide.
| Compound Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-4-fluoro-2,6-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 107328222 |
| Molecular Formula | C12H15ClFNO4S2 |
| Molecular Weight | 355.84 g/mol |
| Exact Mass | 355.01 |
| IUPAC Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-4-fluoro-2,6-dimethylbenzenesulfonamide |
| SMILES | Cc1cc(F)cc(C)c1S(=O)(=O)NC1CS(=O)(=O)CC1Cl |
| InChI | InChI=1S/C12H15ClFNO4S2/c1-7-3-9(14)4-8(2)12(7)21(18,19)15-11-6-20(16,17)5-10(11)13/h3-4,10-11,15H,5-6H2,1-2H3 |
| InChIKey | JUSXMGMZRGIKGY-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.84 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|