C10H11ClFNO4S2 — CID 6978528
N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]-4-fluorobenzenesulfonamide (PubChem CID 6978528) has the molecular formula C10H11ClFNO4S2 and a molecular weight of 327.79 g/mol. Its IUPAC name is N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]-4-fluorobenzenesulfonamide.
| Compound Name | N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]-4-fluorobenzenesulfonamide |
|---|---|
| PubChem CID | 6978528 |
| Molecular Formula | C10H11ClFNO4S2 |
| Molecular Weight | 327.79 g/mol |
| Exact Mass | 326.98 |
| IUPAC Name | N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]-4-fluorobenzenesulfonamide |
| SMILES | O=S1(=O)C[C@@H](Cl)[C@@H](NS(=O)(=O)c2ccc(F)cc2)C1 |
| InChI | InChI=1S/C10H11ClFNO4S2/c11-9-5-18(14,15)6-10(9)13-19(16,17)8-3-1-7(12)2-4-8/h1-4,9-10,13H,5-6H2/t9-,10+/m1/s1 |
| InChIKey | ZETDGWIGXBKOLX-ZJUUUORDSA-N |
| XLogP | 0.51 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.79 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|