C11H11ClN2O4S2 — CID 129393228
N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]-3-cyanobenzenesulfonamide (PubChem CID 129393228) has the molecular formula C11H11ClN2O4S2 and a molecular weight of 334.81 g/mol. Its IUPAC name is N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]-3-cyanobenzenesulfonamide.
| Compound Name | N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]-3-cyanobenzenesulfonamide |
|---|---|
| PubChem CID | 129393228 |
| Molecular Formula | C11H11ClN2O4S2 |
| Molecular Weight | 334.81 g/mol |
| Exact Mass | 333.98 |
| IUPAC Name | N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]-3-cyanobenzenesulfonamide |
| SMILES | N#Cc1cccc(S(=O)(=O)N[C@H]2CS(=O)(=O)C[C@H]2Cl)c1 |
| InChI | InChI=1S/C11H11ClN2O4S2/c12-10-6-19(15,16)7-11(10)14-20(17,18)9-3-1-2-8(4-9)5-13/h1-4,10-11,14H,6-7H2/t10-,11+/m1/s1 |
| InChIKey | MVIKLOZEHDBTBU-MNOVXSKESA-N |
| XLogP | 0.24 |
| TPSA | 104.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.81 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|