C14H15F3N2O2S — CID 24651396
3-cyano-N-[4-(trifluoromethyl)cyclohexyl]benzenesulfonamide (PubChem CID 24651396) has the molecular formula C14H15F3N2O2S and a molecular weight of 332.35 g/mol. Its IUPAC name is 3-cyano-N-[4-(trifluoromethyl)cyclohexyl]benzenesulfonamide.
| Compound Name | 3-cyano-N-[4-(trifluoromethyl)cyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 24651396 |
| Molecular Formula | C14H15F3N2O2S |
| Molecular Weight | 332.35 g/mol |
| Exact Mass | 332.08 |
| IUPAC Name | 3-cyano-N-[4-(trifluoromethyl)cyclohexyl]benzenesulfonamide |
| SMILES | N#Cc1cccc(S(=O)(=O)NC2CCC(C(F)(F)F)CC2)c1 |
| InChI | InChI=1S/C14H15F3N2O2S/c15-14(16,17)11-4-6-12(7-5-11)19-22(20,21)13-3-1-2-10(8-13)9-18/h1-3,8,11-12,19H,4-7H2 |
| InChIKey | MSJXKVPXVHDQBT-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 69.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.35 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |