C13H16N2O3S — CID 104922365
3-cyano-N-[(1R,2R)-2-hydroxycyclohexyl]benzenesulfonamide (PubChem CID 104922365) has the molecular formula C13H16N2O3S and a molecular weight of 280.35 g/mol. Its IUPAC name is 3-cyano-N-[(1R,2R)-2-hydroxycyclohexyl]benzenesulfonamide.
| Compound Name | 3-cyano-N-[(1R,2R)-2-hydroxycyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 104922365 |
| Molecular Formula | C13H16N2O3S |
| Molecular Weight | 280.35 g/mol |
| Exact Mass | 280.09 |
| IUPAC Name | 3-cyano-N-[(1R,2R)-2-hydroxycyclohexyl]benzenesulfonamide |
| SMILES | N#Cc1cccc(S(=O)(=O)N[C@@H]2CCCC[C@H]2O)c1 |
| InChI | InChI=1S/C13H16N2O3S/c14-9-10-4-3-5-11(8-10)19(17,18)15-12-6-1-2-7-13(12)16/h3-5,8,12-13,15-16H,1-2,6-7H2/t12-,13-/m1/s1 |
| InChIKey | OYNZWCZHQQYVAL-CHWSQXEVSA-N |
| XLogP | 1.14 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.35 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |