C14H18N2O3S — CID 104922414
4-(cyanomethyl)-N-[(1R,2R)-2-hydroxycyclohexyl]benzenesulfonamide (PubChem CID 104922414) has the molecular formula C14H18N2O3S and a molecular weight of 294.38 g/mol. Its IUPAC name is 4-(cyanomethyl)-N-[(1R,2R)-2-hydroxycyclohexyl]benzenesulfonamide.
| Compound Name | 4-(cyanomethyl)-N-[(1R,2R)-2-hydroxycyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 104922414 |
| Molecular Formula | C14H18N2O3S |
| Molecular Weight | 294.38 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 4-(cyanomethyl)-N-[(1R,2R)-2-hydroxycyclohexyl]benzenesulfonamide |
| SMILES | N#CCc1ccc(S(=O)(=O)N[C@@H]2CCCC[C@H]2O)cc1 |
| InChI | InChI=1S/C14H18N2O3S/c15-10-9-11-5-7-12(8-6-11)20(18,19)16-13-3-1-2-4-14(13)17/h5-8,13-14,16-17H,1-4,9H2/t13-,14-/m1/s1 |
| InChIKey | ADERWBYCBZVEGJ-ZIAGYGMSSA-N |
| XLogP | 1.33 |
| TPSA | 90.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.38 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |