C13H19NO5S2 — CID 104953140
N-[(1S,2S)-2-hydroxycyclohexyl]-4-methylsulfonylbenzenesulfonamide (PubChem CID 104953140) has the molecular formula C13H19NO5S2 and a molecular weight of 333.43 g/mol. Its IUPAC name is N-[(1S,2S)-2-hydroxycyclohexyl]-4-methylsulfonylbenzenesulfonamide.
| Compound Name | N-[(1S,2S)-2-hydroxycyclohexyl]-4-methylsulfonylbenzenesulfonamide |
|---|---|
| PubChem CID | 104953140 |
| Molecular Formula | C13H19NO5S2 |
| Molecular Weight | 333.43 g/mol |
| Exact Mass | 333.07 |
| IUPAC Name | N-[(1S,2S)-2-hydroxycyclohexyl]-4-methylsulfonylbenzenesulfonamide |
| SMILES | CS(=O)(=O)c1ccc(S(=O)(=O)N[C@H]2CCCC[C@@H]2O)cc1 |
| InChI | InChI=1S/C13H19NO5S2/c1-20(16,17)10-6-8-11(9-7-10)21(18,19)14-12-4-2-3-5-13(12)15/h6-9,12-15H,2-5H2,1H3/t12-,13-/m0/s1 |
| InChIKey | TWKRIFXNEPHQRB-STQMWFEESA-N |
| XLogP | 0.67 |
| TPSA | 100.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.43 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |