C11H18N2O3S — CID 102739268
N-[(1R,2R)-2-hydroxycyclohexyl]-1-methylpyrrole-3-sulfonamide (PubChem CID 102739268) has the molecular formula C11H18N2O3S and a molecular weight of 258.34 g/mol. Its IUPAC name is N-[(1R,2R)-2-hydroxycyclohexyl]-1-methylpyrrole-3-sulfonamide.
| Compound Name | N-[(1R,2R)-2-hydroxycyclohexyl]-1-methylpyrrole-3-sulfonamide |
|---|---|
| PubChem CID | 102739268 |
| Molecular Formula | C11H18N2O3S |
| Molecular Weight | 258.34 g/mol |
| Exact Mass | 258.10 |
| IUPAC Name | N-[(1R,2R)-2-hydroxycyclohexyl]-1-methylpyrrole-3-sulfonamide |
| SMILES | Cn1ccc(S(=O)(=O)N[C@@H]2CCCC[C@H]2O)c1 |
| InChI | InChI=1S/C11H18N2O3S/c1-13-7-6-9(8-13)17(15,16)12-10-4-2-3-5-11(10)14/h6-8,10-12,14H,2-5H2,1H3/t10-,11-/m1/s1 |
| InChIKey | QLGMWKGYCBMTLE-GHMZBOCLSA-N |
| XLogP | 0.61 |
| TPSA | 71.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.34 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |