C13H16F3NO4S — CID 155061379
N-[(1R,2R)-2-hydroxycyclohexyl]-4-(trifluoromethoxy)benzenesulfonamide (PubChem CID 155061379) has the molecular formula C13H16F3NO4S and a molecular weight of 339.34 g/mol. Its IUPAC name is N-[(1R,2R)-2-hydroxycyclohexyl]-4-(trifluoromethoxy)benzenesulfonamide.
| Compound Name | N-[(1R,2R)-2-hydroxycyclohexyl]-4-(trifluoromethoxy)benzenesulfonamide |
|---|---|
| PubChem CID | 155061379 |
| Molecular Formula | C13H16F3NO4S |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | N-[(1R,2R)-2-hydroxycyclohexyl]-4-(trifluoromethoxy)benzenesulfonamide |
| SMILES | O=S(=O)(N[C@@H]1CCCC[C@H]1O)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C13H16F3NO4S/c14-13(15,16)21-9-5-7-10(8-6-9)22(19,20)17-11-3-1-2-4-12(11)18/h5-8,11-12,17-18H,1-4H2/t11-,12-/m1/s1 |
| InChIKey | DCPVYOKEXLTYSB-VXGBXAGGSA-N |
| XLogP | 2.17 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |