C12H16ClNO4S2 — CID 129393220
N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]-3,4-dimethylbenzenesulfonamide (PubChem CID 129393220) has the molecular formula C12H16ClNO4S2 and a molecular weight of 337.85 g/mol. Its IUPAC name is N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]-3,4-dimethylbenzenesulfonamide.
| Compound Name | N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]-3,4-dimethylbenzenesulfonamide |
|---|---|
| PubChem CID | 129393220 |
| Molecular Formula | C12H16ClNO4S2 |
| Molecular Weight | 337.85 g/mol |
| Exact Mass | 337.02 |
| IUPAC Name | N-[(3S,4S)-4-chloro-1,1-dioxothiolan-3-yl]-3,4-dimethylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@H]2CS(=O)(=O)C[C@H]2Cl)cc1C |
| InChI | InChI=1S/C12H16ClNO4S2/c1-8-3-4-10(5-9(8)2)20(17,18)14-12-7-19(15,16)6-11(12)13/h3-5,11-12,14H,6-7H2,1-2H3/t11-,12+/m1/s1 |
| InChIKey | DTQFYRVGKSJORJ-NEPJUHHUSA-N |
| XLogP | 0.99 |
| TPSA | 80.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.85 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|