C15H23NO2S — CID 1256393
3,4-dimethyl-N-[(1R,2R)-2-methylcyclohexyl]benzenesulfonamide (PubChem CID 1256393) has the molecular formula C15H23NO2S and a molecular weight of 281.42 g/mol. Its IUPAC name is 3,4-dimethyl-N-[(1R,2R)-2-methylcyclohexyl]benzenesulfonamide.
| Compound Name | 3,4-dimethyl-N-[(1R,2R)-2-methylcyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 1256393 |
| Molecular Formula | C15H23NO2S |
| Molecular Weight | 281.42 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | 3,4-dimethyl-N-[(1R,2R)-2-methylcyclohexyl]benzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)N[C@@H]2CCCC[C@H]2C)cc1C |
| InChI | InChI=1S/C15H23NO2S/c1-11-8-9-14(10-13(11)3)19(17,18)16-15-7-5-4-6-12(15)2/h8-10,12,15-16H,4-7H2,1-3H3/t12-,15-/m1/s1 |
| InChIKey | PHRCACXABFRXCW-IUODEOHRSA-N |
| XLogP | 3.16 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.42 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |