C17H27NO4S — CID 50876225
3,4-diethoxy-N-(2-methylcyclohexyl)benzenesulfonamide (PubChem CID 50876225) has the molecular formula C17H27NO4S and a molecular weight of 341.47 g/mol. Its IUPAC name is 3,4-diethoxy-N-(2-methylcyclohexyl)benzenesulfonamide.
| Compound Name | 3,4-diethoxy-N-(2-methylcyclohexyl)benzenesulfonamide |
|---|---|
| PubChem CID | 50876225 |
| Molecular Formula | C17H27NO4S |
| Molecular Weight | 341.47 g/mol |
| Exact Mass | 341.17 |
| IUPAC Name | 3,4-diethoxy-N-(2-methylcyclohexyl)benzenesulfonamide |
| SMILES | CCOc1ccc(S(=O)(=O)NC2CCCCC2C)cc1OCC |
| InChI | InChI=1S/C17H27NO4S/c1-4-21-16-11-10-14(12-17(16)22-5-2)23(19,20)18-15-9-7-6-8-13(15)3/h10-13,15,18H,4-9H2,1-3H3 |
| InChIKey | WQXQATNIKBZHOS-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.47 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |