C19H31NO4S — CID 95864987
N-[(1S,2S)-2-methylcyclohexyl]-3,4-dipropoxybenzenesulfonamide (PubChem CID 95864987) has the molecular formula C19H31NO4S and a molecular weight of 369.53 g/mol. Its IUPAC name is N-[(1S,2S)-2-methylcyclohexyl]-3,4-dipropoxybenzenesulfonamide.
| Compound Name | N-[(1S,2S)-2-methylcyclohexyl]-3,4-dipropoxybenzenesulfonamide |
|---|---|
| PubChem CID | 95864987 |
| Molecular Formula | C19H31NO4S |
| Molecular Weight | 369.53 g/mol |
| Exact Mass | 369.20 |
| IUPAC Name | N-[(1S,2S)-2-methylcyclohexyl]-3,4-dipropoxybenzenesulfonamide |
| SMILES | CCCOc1ccc(S(=O)(=O)N[C@H]2CCCC[C@@H]2C)cc1OCCC |
| InChI | InChI=1S/C19H31NO4S/c1-4-12-23-18-11-10-16(14-19(18)24-13-5-2)25(21,22)20-17-9-7-6-8-15(17)3/h10-11,14-15,17,20H,4-9,12-13H2,1-3H3/t15-,17-/m0/s1 |
| InChIKey | DVZVDGDOOBZBFH-RDJZCZTQSA-N |
| XLogP | 4.12 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.53 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |