C17H26ClNO3S — CID 35202724
3-butoxy-4-chloro-N-[(1R,2S)-2-methylcyclohexyl]benzenesulfonamide (PubChem CID 35202724) has the molecular formula C17H26ClNO3S and a molecular weight of 359.92 g/mol. Its IUPAC name is 3-butoxy-4-chloro-N-[(1R,2S)-2-methylcyclohexyl]benzenesulfonamide.
| Compound Name | 3-butoxy-4-chloro-N-[(1R,2S)-2-methylcyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 35202724 |
| Molecular Formula | C17H26ClNO3S |
| Molecular Weight | 359.92 g/mol |
| Exact Mass | 359.13 |
| IUPAC Name | 3-butoxy-4-chloro-N-[(1R,2S)-2-methylcyclohexyl]benzenesulfonamide |
| SMILES | CCCCOc1cc(S(=O)(=O)N[C@@H]2CCCC[C@@H]2C)ccc1Cl |
| InChI | InChI=1S/C17H26ClNO3S/c1-3-4-11-22-17-12-14(9-10-15(17)18)23(20,21)19-16-8-6-5-7-13(16)2/h9-10,12-13,16,19H,3-8,11H2,1-2H3/t13-,16+/m0/s1 |
| InChIKey | KFXGEZQEBUONTI-XJKSGUPXSA-N |
| XLogP | 4.38 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.92 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|