C15H22ClNO3S — CID 40793418
5-chloro-2-ethoxy-N-[(1R,2S)-2-methylcyclohexyl]benzenesulfonamide (PubChem CID 40793418) has the molecular formula C15H22ClNO3S and a molecular weight of 331.87 g/mol. Its IUPAC name is 5-chloro-2-ethoxy-N-[(1R,2S)-2-methylcyclohexyl]benzenesulfonamide.
| Compound Name | 5-chloro-2-ethoxy-N-[(1R,2S)-2-methylcyclohexyl]benzenesulfonamide |
|---|---|
| PubChem CID | 40793418 |
| Molecular Formula | C15H22ClNO3S |
| Molecular Weight | 331.87 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | 5-chloro-2-ethoxy-N-[(1R,2S)-2-methylcyclohexyl]benzenesulfonamide |
| SMILES | CCOc1ccc(Cl)cc1S(=O)(=O)N[C@@H]1CCCC[C@@H]1C |
| InChI | InChI=1S/C15H22ClNO3S/c1-3-20-14-9-8-12(16)10-15(14)21(18,19)17-13-7-5-4-6-11(13)2/h8-11,13,17H,3-7H2,1-2H3/t11-,13+/m0/s1 |
| InChIKey | QMCSYJJQFHJPAW-WCQYABFASA-N |
| XLogP | 3.60 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.87 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |