C8H12ClN3O4S2 — CID 113290314
N-(4-chloro-1,1-dioxothiolan-3-yl)-1-methylimidazole-4-sulfonamide (PubChem CID 113290314) has the molecular formula C8H12ClN3O4S2 and a molecular weight of 313.79 g/mol. Its IUPAC name is N-(4-chloro-1,1-dioxothiolan-3-yl)-1-methylimidazole-4-sulfonamide.
| Compound Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 113290314 |
| Molecular Formula | C8H12ClN3O4S2 |
| Molecular Weight | 313.79 g/mol |
| Exact Mass | 313.00 |
| IUPAC Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-1-methylimidazole-4-sulfonamide |
| SMILES | Cn1cnc(S(=O)(=O)NC2CS(=O)(=O)CC2Cl)c1 |
| InChI | InChI=1S/C8H12ClN3O4S2/c1-12-2-8(10-5-12)18(15,16)11-7-4-17(13,14)3-6(7)9/h2,5-7,11H,3-4H2,1H3 |
| InChIKey | UUOALBNFJPCEKC-UHFFFAOYSA-N |
| XLogP | -0.90 |
| TPSA | 98.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.79 |
| LogP ≤ 5 | -0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|