C16H21N3O4S — CID 110125730
N-[(1R,2R,3R)-2-hydroxy-3-phenoxycyclohexyl]-1-methylimidazole-4-sulfonamide (PubChem CID 110125730) has the molecular formula C16H21N3O4S and a molecular weight of 351.43 g/mol. Its IUPAC name is N-[(1R,2R,3R)-2-hydroxy-3-phenoxycyclohexyl]-1-methylimidazole-4-sulfonamide.
| Compound Name | N-[(1R,2R,3R)-2-hydroxy-3-phenoxycyclohexyl]-1-methylimidazole-4-sulfonamide |
|---|---|
| PubChem CID | 110125730 |
| Molecular Formula | C16H21N3O4S |
| Molecular Weight | 351.43 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | N-[(1R,2R,3R)-2-hydroxy-3-phenoxycyclohexyl]-1-methylimidazole-4-sulfonamide |
| SMILES | Cn1cnc(S(=O)(=O)N[C@@H]2CCC[C@@H](Oc3ccccc3)[C@@H]2O)c1 |
| InChI | InChI=1S/C16H21N3O4S/c1-19-10-15(17-11-19)24(21,22)18-13-8-5-9-14(16(13)20)23-12-6-3-2-4-7-12/h2-4,6-7,10-11,13-14,16,18,20H,5,8-9H2,1H3/t13-,14-,16-/m1/s1 |
| InChIKey | OJNRYOFHTWHOPO-IIAWOOMASA-N |
| XLogP | 1.06 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.43 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |