C20H21N3O3S — CID 125481047
1-methyl-4-[(3R,4R)-3-phenoxy-4-phenylpyrrolidin-1-yl]sulfonylimidazole (PubChem CID 125481047) has the molecular formula C20H21N3O3S and a molecular weight of 383.47 g/mol. Its IUPAC name is 1-methyl-4-[(3R,4R)-3-phenoxy-4-phenylpyrrolidin-1-yl]sulfonylimidazole.
| Compound Name | 1-methyl-4-[(3R,4R)-3-phenoxy-4-phenylpyrrolidin-1-yl]sulfonylimidazole |
|---|---|
| PubChem CID | 125481047 |
| Molecular Formula | C20H21N3O3S |
| Molecular Weight | 383.47 g/mol |
| Exact Mass | 383.13 |
| IUPAC Name | 1-methyl-4-[(3R,4R)-3-phenoxy-4-phenylpyrrolidin-1-yl]sulfonylimidazole |
| SMILES | Cn1cnc(S(=O)(=O)N2C[C@H](Oc3ccccc3)[C@H](c3ccccc3)C2)c1 |
| InChI | InChI=1S/C20H21N3O3S/c1-22-14-20(21-15-22)27(24,25)23-12-18(16-8-4-2-5-9-16)19(13-23)26-17-10-6-3-7-11-17/h2-11,14-15,18-19H,12-13H2,1H3/t18-,19-/m0/s1 |
| InChIKey | LUFJIIKQYHTRSE-OALUTQOASA-N |
| XLogP | 2.66 |
| TPSA | 64.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.47 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |