C17H20FN3O5S — CID 90405786
methyl 2-[4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidin-3-yl]oxyacetate (PubChem CID 90405786) has the molecular formula C17H20FN3O5S and a molecular weight of 397.43 g/mol. Its IUPAC name is methyl 2-[4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidin-3-yl]oxyacetate.
| Compound Name | methyl 2-[4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidin-3-yl]oxyacetate |
|---|---|
| PubChem CID | 90405786 |
| Molecular Formula | C17H20FN3O5S |
| Molecular Weight | 397.43 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | methyl 2-[4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidin-3-yl]oxyacetate |
| SMILES | COC(=O)COC1CN(S(=O)(=O)c2cn(C)cn2)CC1c1ccc(F)cc1 |
| InChI | InChI=1S/C17H20FN3O5S/c1-20-9-16(19-11-20)27(23,24)21-7-14(12-3-5-13(18)6-4-12)15(8-21)26-10-17(22)25-2/h3-6,9,11,14-15H,7-8,10H2,1-2H3 |
| InChIKey | HIPWRQJCDBZVOO-UHFFFAOYSA-N |
| XLogP | 0.91 |
| TPSA | 90.73 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.43 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |