C18H25FN4O2S — CID 90406385
N-[[(3R,4R)-4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidin-3-yl]methyl]propan-1-amine (PubChem CID 90406385) has the molecular formula C18H25FN4O2S and a molecular weight of 380.49 g/mol. Its IUPAC name is N-[[(3R,4R)-4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidin-3-yl]methyl]propan-1-amine.
| Compound Name | N-[[(3R,4R)-4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidin-3-yl]methyl]propan-1-amine |
|---|---|
| PubChem CID | 90406385 |
| Molecular Formula | C18H25FN4O2S |
| Molecular Weight | 380.49 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | N-[[(3R,4R)-4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidin-3-yl]methyl]propan-1-amine |
| SMILES | CCCNC[C@@H]1CN(S(=O)(=O)c2cn(C)cn2)C[C@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C18H25FN4O2S/c1-3-8-20-9-15-10-23(26(24,25)18-12-22(2)13-21-18)11-17(15)14-4-6-16(19)7-5-14/h4-7,12-13,15,17,20H,3,8-11H2,1-2H3/t15-,17+/m1/s1 |
| InChIKey | OSRVLFQRRGNFDC-WBVHZDCISA-N |
| XLogP | 1.96 |
| TPSA | 67.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.49 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|