C19H27FN4O3S — CID 90406632
2-ethoxy-N-[[(3S,4S)-4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidin-3-yl]methyl]ethanamine (PubChem CID 90406632) has the molecular formula C19H27FN4O3S and a molecular weight of 410.52 g/mol. Its IUPAC name is 2-ethoxy-N-[[(3S,4S)-4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidin-3-yl]methyl]ethanamine.
| Compound Name | 2-ethoxy-N-[[(3S,4S)-4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidin-3-yl]methyl]ethanamine |
|---|---|
| PubChem CID | 90406632 |
| Molecular Formula | C19H27FN4O3S |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.18 |
| IUPAC Name | 2-ethoxy-N-[[(3S,4S)-4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidin-3-yl]methyl]ethanamine |
| SMILES | CCOCCNC[C@H]1CN(S(=O)(=O)c2cn(C)cn2)C[C@@H]1c1ccc(F)cc1 |
| InChI | InChI=1S/C19H27FN4O3S/c1-3-27-9-8-21-10-16-11-24(28(25,26)19-13-23(2)14-22-19)12-18(16)15-4-6-17(20)7-5-15/h4-7,13-14,16,18,21H,3,8-12H2,1-2H3/t16-,18+/m0/s1 |
| InChIKey | WAPKXLNQYVDKHA-FUHWJXTLSA-N |
| XLogP | 1.59 |
| TPSA | 76.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|