C21H21FN4O3S — CID 90404252
4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonyl-N-phenylpyrrolidine-3-carboxamide (PubChem CID 90404252) has the molecular formula C21H21FN4O3S and a molecular weight of 428.49 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonyl-N-phenylpyrrolidine-3-carboxamide.
| Compound Name | 4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonyl-N-phenylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 90404252 |
| Molecular Formula | C21H21FN4O3S |
| Molecular Weight | 428.49 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 4-(4-fluorophenyl)-1-(1-methylimidazol-4-yl)sulfonyl-N-phenylpyrrolidine-3-carboxamide |
| SMILES | Cn1cnc(S(=O)(=O)N2CC(C(=O)Nc3ccccc3)C(c3ccc(F)cc3)C2)c1 |
| InChI | InChI=1S/C21H21FN4O3S/c1-25-13-20(23-14-25)30(28,29)26-11-18(15-7-9-16(22)10-8-15)19(12-26)21(27)24-17-5-3-2-4-6-17/h2-10,13-14,18-19H,11-12H2,1H3,(H,24,27) |
| InChIKey | AQEZDPKBNFDNLJ-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.49 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |