C23H33FN4O3S — CID 90406929
4-(4-fluorophenyl)-N-(6-methylheptyl)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidine-3-carboxamide (PubChem CID 90406929) has the molecular formula C23H33FN4O3S and a molecular weight of 464.61 g/mol. Its IUPAC name is 4-(4-fluorophenyl)-N-(6-methylheptyl)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidine-3-carboxamide.
| Compound Name | 4-(4-fluorophenyl)-N-(6-methylheptyl)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidine-3-carboxamide |
|---|---|
| PubChem CID | 90406929 |
| Molecular Formula | C23H33FN4O3S |
| Molecular Weight | 464.61 g/mol |
| Exact Mass | 464.23 |
| IUPAC Name | 4-(4-fluorophenyl)-N-(6-methylheptyl)-1-(1-methylimidazol-4-yl)sulfonylpyrrolidine-3-carboxamide |
| SMILES | CC(C)CCCCCNC(=O)C1CN(S(=O)(=O)c2cn(C)cn2)CC1c1ccc(F)cc1 |
| InChI | InChI=1S/C23H33FN4O3S/c1-17(2)7-5-4-6-12-25-23(29)21-14-28(32(30,31)22-15-27(3)16-26-22)13-20(21)18-8-10-19(24)11-9-18/h8-11,15-17,20-21H,4-7,12-14H2,1-3H3,(H,25,29) |
| InChIKey | GBXOGODGHNIXNH-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.61 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|