C16H22N4O3S — CID 176500898
1-methyl-N-[4-[(2-methyl-3-pyridinyl)oxy]cyclohexyl]imidazole-4-sulfonamide (PubChem CID 176500898) has the molecular formula C16H22N4O3S and a molecular weight of 350.44 g/mol. Its IUPAC name is 1-methyl-N-[4-[(2-methyl-3-pyridinyl)oxy]cyclohexyl]imidazole-4-sulfonamide.
| Compound Name | 1-methyl-N-[4-[(2-methyl-3-pyridinyl)oxy]cyclohexyl]imidazole-4-sulfonamide |
|---|---|
| PubChem CID | 176500898 |
| Molecular Formula | C16H22N4O3S |
| Molecular Weight | 350.44 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | 1-methyl-N-[4-[(2-methyl-3-pyridinyl)oxy]cyclohexyl]imidazole-4-sulfonamide |
| SMILES | Cc1ncccc1OC1CCC(NS(=O)(=O)c2cn(C)cn2)CC1 |
| InChI | InChI=1S/C16H22N4O3S/c1-12-15(4-3-9-17-12)23-14-7-5-13(6-8-14)19-24(21,22)16-10-20(2)11-18-16/h3-4,9-11,13-14,19H,5-8H2,1-2H3 |
| InChIKey | JXGGWSBSMNWERW-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 86.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.44 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |