C7H11Cl2NO3S — CID 130631308
2-chloro-N-(4-chloro-1,1-dioxothiolan-3-yl)propanamide (PubChem CID 130631308) has the molecular formula C7H11Cl2NO3S and a molecular weight of 260.14 g/mol. Its IUPAC name is 2-chloro-N-(4-chloro-1,1-dioxothiolan-3-yl)propanamide.
| Compound Name | 2-chloro-N-(4-chloro-1,1-dioxothiolan-3-yl)propanamide |
|---|---|
| PubChem CID | 130631308 |
| Molecular Formula | C7H11Cl2NO3S |
| Molecular Weight | 260.14 g/mol |
| Exact Mass | 258.98 |
| IUPAC Name | 2-chloro-N-(4-chloro-1,1-dioxothiolan-3-yl)propanamide |
| SMILES | CC(Cl)C(=O)NC1CS(=O)(=O)CC1Cl |
| InChI | InChI=1S/C7H11Cl2NO3S/c1-4(8)7(11)10-6-3-14(12,13)2-5(6)9/h4-6H,2-3H2,1H3,(H,10,11) |
| InChIKey | LMLJVMYSRSNAMK-UHFFFAOYSA-N |
| XLogP | 0.13 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.14 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|