C10H16ClNO3S — CID 103164394
N-(4-chloro-1,1-dioxothiolan-3-yl)-2-cyclobutylacetamide (PubChem CID 103164394) has the molecular formula C10H16ClNO3S and a molecular weight of 265.76 g/mol. Its IUPAC name is N-(4-chloro-1,1-dioxothiolan-3-yl)-2-cyclobutylacetamide.
| Compound Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-2-cyclobutylacetamide |
|---|---|
| PubChem CID | 103164394 |
| Molecular Formula | C10H16ClNO3S |
| Molecular Weight | 265.76 g/mol |
| Exact Mass | 265.05 |
| IUPAC Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-2-cyclobutylacetamide |
| SMILES | O=C(CC1CCC1)NC1CS(=O)(=O)CC1Cl |
| InChI | InChI=1S/C10H16ClNO3S/c11-8-5-16(14,15)6-9(8)12-10(13)4-7-2-1-3-7/h7-9H,1-6H2,(H,12,13) |
| InChIKey | VPQFHZJVYRUDEE-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.76 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|