C11H18ClNO3S2 — CID 83135920
N-(4-chloro-1,1-dioxothiolan-3-yl)-2-(thian-4-yl)acetamide (PubChem CID 83135920) has the molecular formula C11H18ClNO3S2 and a molecular weight of 311.86 g/mol. Its IUPAC name is N-(4-chloro-1,1-dioxothiolan-3-yl)-2-(thian-4-yl)acetamide.
| Compound Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-2-(thian-4-yl)acetamide |
|---|---|
| PubChem CID | 83135920 |
| Molecular Formula | C11H18ClNO3S2 |
| Molecular Weight | 311.86 g/mol |
| Exact Mass | 311.04 |
| IUPAC Name | N-(4-chloro-1,1-dioxothiolan-3-yl)-2-(thian-4-yl)acetamide |
| SMILES | O=C(CC1CCSCC1)NC1CS(=O)(=O)CC1Cl |
| InChI | InChI=1S/C11H18ClNO3S2/c12-9-6-18(15,16)7-10(9)13-11(14)5-8-1-3-17-4-2-8/h8-10H,1-7H2,(H,13,14) |
| InChIKey | WDVNABQFABQQES-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.86 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|