C20H26N2O4S — CID 171146740
N-[(3S,4R)-4-[(2-cyclopentylacetyl)amino]-1,1-dioxothiolan-3-yl]-3-phenylprop-2-enamide (PubChem CID 171146740) has the molecular formula C20H26N2O4S and a molecular weight of 390.51 g/mol. Its IUPAC name is N-[(3S,4R)-4-[(2-cyclopentylacetyl)amino]-1,1-dioxothiolan-3-yl]-3-phenylprop-2-enamide.
| Compound Name | N-[(3S,4R)-4-[(2-cyclopentylacetyl)amino]-1,1-dioxothiolan-3-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 171146740 |
| Molecular Formula | C20H26N2O4S |
| Molecular Weight | 390.51 g/mol |
| Exact Mass | 390.16 |
| IUPAC Name | N-[(3S,4R)-4-[(2-cyclopentylacetyl)amino]-1,1-dioxothiolan-3-yl]-3-phenylprop-2-enamide |
| SMILES | O=C(C=Cc1ccccc1)N[C@@H]1CS(=O)(=O)C[C@@H]1NC(=O)CC1CCCC1 |
| InChI | InChI=1S/C20H26N2O4S/c23-19(11-10-15-6-2-1-3-7-15)21-17-13-27(25,26)14-18(17)22-20(24)12-16-8-4-5-9-16/h1-3,6-7,10-11,16-18H,4-5,8-9,12-14H2,(H,21,23)(H,22,24)/t17-,18+/m1/s1 |
| InChIKey | YWXKRVCVMWHIAH-MSOLQXFVSA-N |
| XLogP | 1.68 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.51 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|