C17H22N2O — CID 138380557
(E)-N-[(8S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-yl]-3-phenylprop-2-enamide (PubChem CID 138380557) has the molecular formula C17H22N2O and a molecular weight of 270.38 g/mol. Its IUPAC name is (E)-N-[(8S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-yl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(8S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 138380557 |
| Molecular Formula | C17H22N2O |
| Molecular Weight | 270.38 g/mol |
| Exact Mass | 270.17 |
| IUPAC Name | (E)-N-[(8S,8aS)-1,2,3,5,6,7,8,8a-octahydroindolizin-8-yl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)N[C@H]1CCCN2CCC[C@@H]12 |
| InChI | InChI=1S/C17H22N2O/c20-17(11-10-14-6-2-1-3-7-14)18-15-8-4-12-19-13-5-9-16(15)19/h1-3,6-7,10-11,15-16H,4-5,8-9,12-13H2,(H,18,20)/b11-10+/t15-,16-/m0/s1 |
| InChIKey | XMXQNNRSHVAIMO-ISEXYEMMSA-N |
| XLogP | 2.44 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.38 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|