C20H25FN2O3 — CID 165425002
(E)-N-[(1S,2S,4S)-4-(4-fluoropiperidine-1-carbonyl)-2-hydroxycyclopentyl]-3-phenylprop-2-enamide (PubChem CID 165425002) has the molecular formula C20H25FN2O3 and a molecular weight of 360.43 g/mol. Its IUPAC name is (E)-N-[(1S,2S,4S)-4-(4-fluoropiperidine-1-carbonyl)-2-hydroxycyclopentyl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[(1S,2S,4S)-4-(4-fluoropiperidine-1-carbonyl)-2-hydroxycyclopentyl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 165425002 |
| Molecular Formula | C20H25FN2O3 |
| Molecular Weight | 360.43 g/mol |
| Exact Mass | 360.18 |
| IUPAC Name | (E)-N-[(1S,2S,4S)-4-(4-fluoropiperidine-1-carbonyl)-2-hydroxycyclopentyl]-3-phenylprop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1)N[C@H]1C[C@H](C(=O)N2CCC(F)CC2)C[C@@H]1O |
| InChI | InChI=1S/C20H25FN2O3/c21-16-8-10-23(11-9-16)20(26)15-12-17(18(24)13-15)22-19(25)7-6-14-4-2-1-3-5-14/h1-7,15-18,24H,8-13H2,(H,22,25)/b7-6+/t15-,17-,18-/m0/s1 |
| InChIKey | PPRMNYQZCYQTMF-AMGAKCQWSA-N |
| XLogP | 1.92 |
| TPSA | 69.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.43 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|