C21H26N4O3 — CID 155919172
(1S,3S,4S)-N-[(1-ethylimidazol-4-yl)methyl]-3-hydroxy-4-[[(E)-3-phenylprop-2-enoyl]amino]cyclopentane-1-carboxamide (PubChem CID 155919172) has the molecular formula C21H26N4O3 and a molecular weight of 382.46 g/mol. Its IUPAC name is (1S,3S,4S)-N-[(1-ethylimidazol-4-yl)methyl]-3-hydroxy-4-[[(E)-3-phenylprop-2-enoyl]amino]cyclopentane-1-carboxamide.
| Compound Name | (1S,3S,4S)-N-[(1-ethylimidazol-4-yl)methyl]-3-hydroxy-4-[[(E)-3-phenylprop-2-enoyl]amino]cyclopentane-1-carboxamide |
|---|---|
| PubChem CID | 155919172 |
| Molecular Formula | C21H26N4O3 |
| Molecular Weight | 382.46 g/mol |
| Exact Mass | 382.20 |
| IUPAC Name | (1S,3S,4S)-N-[(1-ethylimidazol-4-yl)methyl]-3-hydroxy-4-[[(E)-3-phenylprop-2-enoyl]amino]cyclopentane-1-carboxamide |
| SMILES | CCn1cnc(CNC(=O)[C@H]2C[C@H](NC(=O)/C=C/c3ccccc3)[C@@H](O)C2)c1 |
| InChI | InChI=1S/C21H26N4O3/c1-2-25-13-17(23-14-25)12-22-21(28)16-10-18(19(26)11-16)24-20(27)9-8-15-6-4-3-5-7-15/h3-9,13-14,16,18-19,26H,2,10-12H2,1H3,(H,22,28)(H,24,27)/b9-8+/t16-,18-,19-/m0/s1 |
| InChIKey | ZUQIMOQDEGBOTC-JMPVAQNPSA-N |
| XLogP | 1.49 |
| TPSA | 96.25 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.46 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|