C24H33N3O3 — CID 55691057
N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-2-[[(E)-3-phenylprop-2-enoyl]amino]propanamide (PubChem CID 55691057) has the molecular formula C24H33N3O3 and a molecular weight of 411.55 g/mol. Its IUPAC name is N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-2-[[(E)-3-phenylprop-2-enoyl]amino]propanamide.
| Compound Name | N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-2-[[(E)-3-phenylprop-2-enoyl]amino]propanamide |
|---|---|
| PubChem CID | 55691057 |
| Molecular Formula | C24H33N3O3 |
| Molecular Weight | 411.55 g/mol |
| Exact Mass | 411.25 |
| IUPAC Name | N-[1-(cyclohexanecarbonyl)piperidin-4-yl]-2-[[(E)-3-phenylprop-2-enoyl]amino]propanamide |
| SMILES | CC(NC(=O)/C=C/c1ccccc1)C(=O)NC1CCN(C(=O)C2CCCCC2)CC1 |
| InChI | InChI=1S/C24H33N3O3/c1-18(25-22(28)13-12-19-8-4-2-5-9-19)23(29)26-21-14-16-27(17-15-21)24(30)20-10-6-3-7-11-20/h2,4-5,8-9,12-13,18,20-21H,3,6-7,10-11,14-17H2,1H3,(H,25,28)(H,26,29)/b13-12+ |
| InChIKey | YBQJMBZLJOMLBJ-OUKQBFOZSA-N |
| XLogP | 2.89 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.55 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|