C19H20F6N2O — CID 71895462
N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-3-[3,5-bis(trifluoromethyl)phenyl]prop-2-enamide (PubChem CID 71895462) has the molecular formula C19H20F6N2O and a molecular weight of 406.37 g/mol. Its IUPAC name is N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-3-[3,5-bis(trifluoromethyl)phenyl]prop-2-enamide.
| Compound Name | N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-3-[3,5-bis(trifluoromethyl)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 71895462 |
| Molecular Formula | C19H20F6N2O |
| Molecular Weight | 406.37 g/mol |
| Exact Mass | 406.15 |
| IUPAC Name | N-(1,2,3,5,6,7,8,8a-octahydroindolizin-1-yl)-3-[3,5-bis(trifluoromethyl)phenyl]prop-2-enamide |
| SMILES | O=C(C=Cc1cc(C(F)(F)F)cc(C(F)(F)F)c1)NC1CCN2CCCCC12 |
| InChI | InChI=1S/C19H20F6N2O/c20-18(21,22)13-9-12(10-14(11-13)19(23,24)25)4-5-17(28)26-15-6-8-27-7-2-1-3-16(15)27/h4-5,9-11,15-16H,1-3,6-8H2,(H,26,28) |
| InChIKey | FSBSGBLKRUJPFI-UHFFFAOYSA-N |
| XLogP | 4.48 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.37 |
| LogP ≤ 5 | 4.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|