C18H20ClF3N2O3S — CID 56520802
(E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-(1,1-dioxo-4-pyrrolidin-1-ylthiolan-3-yl)prop-2-enamide (PubChem CID 56520802) has the molecular formula C18H20ClF3N2O3S and a molecular weight of 436.88 g/mol. Its IUPAC name is (E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-(1,1-dioxo-4-pyrrolidin-1-ylthiolan-3-yl)prop-2-enamide.
| Compound Name | (E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-(1,1-dioxo-4-pyrrolidin-1-ylthiolan-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 56520802 |
| Molecular Formula | C18H20ClF3N2O3S |
| Molecular Weight | 436.88 g/mol |
| Exact Mass | 436.08 |
| IUPAC Name | (E)-3-[2-chloro-5-(trifluoromethyl)phenyl]-N-(1,1-dioxo-4-pyrrolidin-1-ylthiolan-3-yl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cc(C(F)(F)F)ccc1Cl)NC1CS(=O)(=O)CC1N1CCCC1 |
| InChI | InChI=1S/C18H20ClF3N2O3S/c19-14-5-4-13(18(20,21)22)9-12(14)3-6-17(25)23-15-10-28(26,27)11-16(15)24-7-1-2-8-24/h3-6,9,15-16H,1-2,7-8,10-11H2,(H,23,25)/b6-3+ |
| InChIKey | QCUUSSDOVWYPED-ZZXKWVIFSA-N |
| XLogP | 2.75 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.88 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|