C19H24F2N2O5S — CID 56520803
(E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-(1,1-dioxo-4-pyrrolidin-1-ylthiolan-3-yl)prop-2-enamide (PubChem CID 56520803) has the molecular formula C19H24F2N2O5S and a molecular weight of 430.47 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-(1,1-dioxo-4-pyrrolidin-1-ylthiolan-3-yl)prop-2-enamide.
| Compound Name | (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-(1,1-dioxo-4-pyrrolidin-1-ylthiolan-3-yl)prop-2-enamide |
|---|---|
| PubChem CID | 56520803 |
| Molecular Formula | C19H24F2N2O5S |
| Molecular Weight | 430.47 g/mol |
| Exact Mass | 430.14 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-(1,1-dioxo-4-pyrrolidin-1-ylthiolan-3-yl)prop-2-enamide |
| SMILES | COc1cccc(/C=C/C(=O)NC2CS(=O)(=O)CC2N2CCCC2)c1OC(F)F |
| InChI | InChI=1S/C19H24F2N2O5S/c1-27-16-6-4-5-13(18(16)28-19(20)21)7-8-17(24)22-14-11-29(25,26)12-15(14)23-9-2-3-10-23/h4-8,14-15,19H,2-3,9-12H2,1H3,(H,22,24)/b8-7+ |
| InChIKey | ZQVCLGSQPVHSOU-BQYQJAHWSA-N |
| XLogP | 1.69 |
| TPSA | 84.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.47 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|