C20H28N2O4S — CID 56520798
(E)-N-(1,1-dioxo-4-piperidin-1-ylthiolan-3-yl)-3-(2-methoxy-5-methylphenyl)prop-2-enamide (PubChem CID 56520798) has the molecular formula C20H28N2O4S and a molecular weight of 392.52 g/mol. Its IUPAC name is (E)-N-(1,1-dioxo-4-piperidin-1-ylthiolan-3-yl)-3-(2-methoxy-5-methylphenyl)prop-2-enamide.
| Compound Name | (E)-N-(1,1-dioxo-4-piperidin-1-ylthiolan-3-yl)-3-(2-methoxy-5-methylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 56520798 |
| Molecular Formula | C20H28N2O4S |
| Molecular Weight | 392.52 g/mol |
| Exact Mass | 392.18 |
| IUPAC Name | (E)-N-(1,1-dioxo-4-piperidin-1-ylthiolan-3-yl)-3-(2-methoxy-5-methylphenyl)prop-2-enamide |
| SMILES | COc1ccc(C)cc1/C=C/C(=O)NC1CS(=O)(=O)CC1N1CCCCC1 |
| InChI | InChI=1S/C20H28N2O4S/c1-15-6-8-19(26-2)16(12-15)7-9-20(23)21-17-13-27(24,25)14-18(17)22-10-4-3-5-11-22/h6-9,12,17-18H,3-5,10-11,13-14H2,1-2H3,(H,21,23)/b9-7+ |
| InChIKey | ULSZTKYXLJXKRL-VQHVLOKHSA-N |
| XLogP | 1.78 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.52 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|