C14H24N2O3S — CID 95333224
N-[(3S,4R)-1,1-dioxo-4-piperidin-1-ylthiolan-3-yl]-3-methylbut-2-enamide (PubChem CID 95333224) has the molecular formula C14H24N2O3S and a molecular weight of 300.42 g/mol. Its IUPAC name is N-[(3S,4R)-1,1-dioxo-4-piperidin-1-ylthiolan-3-yl]-3-methylbut-2-enamide.
| Compound Name | N-[(3S,4R)-1,1-dioxo-4-piperidin-1-ylthiolan-3-yl]-3-methylbut-2-enamide |
|---|---|
| PubChem CID | 95333224 |
| Molecular Formula | C14H24N2O3S |
| Molecular Weight | 300.42 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | N-[(3S,4R)-1,1-dioxo-4-piperidin-1-ylthiolan-3-yl]-3-methylbut-2-enamide |
| SMILES | CC(C)=CC(=O)N[C@@H]1CS(=O)(=O)C[C@@H]1N1CCCCC1 |
| InChI | InChI=1S/C14H24N2O3S/c1-11(2)8-14(17)15-12-9-20(18,19)10-13(12)16-6-4-3-5-7-16/h8,12-13H,3-7,9-10H2,1-2H3,(H,15,17)/t12-,13+/m1/s1 |
| InChIKey | KPZQPNVESYWXJW-OLZOCXBDSA-N |
| XLogP | 0.72 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.42 |
| LogP ≤ 5 | 0.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|