C21H30N2O4S — CID 56522333
(E)-N-(1,1-dioxo-4-piperidin-1-ylthiolan-3-yl)-3-(4-propoxyphenyl)prop-2-enamide (PubChem CID 56522333) has the molecular formula C21H30N2O4S and a molecular weight of 406.55 g/mol. Its IUPAC name is (E)-N-(1,1-dioxo-4-piperidin-1-ylthiolan-3-yl)-3-(4-propoxyphenyl)prop-2-enamide.
| Compound Name | (E)-N-(1,1-dioxo-4-piperidin-1-ylthiolan-3-yl)-3-(4-propoxyphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 56522333 |
| Molecular Formula | C21H30N2O4S |
| Molecular Weight | 406.55 g/mol |
| Exact Mass | 406.19 |
| IUPAC Name | (E)-N-(1,1-dioxo-4-piperidin-1-ylthiolan-3-yl)-3-(4-propoxyphenyl)prop-2-enamide |
| SMILES | CCCOc1ccc(/C=C/C(=O)NC2CS(=O)(=O)CC2N2CCCCC2)cc1 |
| InChI | InChI=1S/C21H30N2O4S/c1-2-14-27-18-9-6-17(7-10-18)8-11-21(24)22-19-15-28(25,26)16-20(19)23-12-4-3-5-13-23/h6-11,19-20H,2-5,12-16H2,1H3,(H,22,24)/b11-8+ |
| InChIKey | ARPUDEPOXAAOAP-DHZHZOJOSA-N |
| XLogP | 2.26 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.55 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|