C23H27N3O4S — CID 56520558
(E)-N-(1,1-dioxo-4-pyrrolidin-1-ylthiolan-3-yl)-3-[4-(pyridin-3-ylmethoxy)phenyl]prop-2-enamide (PubChem CID 56520558) has the molecular formula C23H27N3O4S and a molecular weight of 441.55 g/mol. Its IUPAC name is (E)-N-(1,1-dioxo-4-pyrrolidin-1-ylthiolan-3-yl)-3-[4-(pyridin-3-ylmethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-N-(1,1-dioxo-4-pyrrolidin-1-ylthiolan-3-yl)-3-[4-(pyridin-3-ylmethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 56520558 |
| Molecular Formula | C23H27N3O4S |
| Molecular Weight | 441.55 g/mol |
| Exact Mass | 441.17 |
| IUPAC Name | (E)-N-(1,1-dioxo-4-pyrrolidin-1-ylthiolan-3-yl)-3-[4-(pyridin-3-ylmethoxy)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(OCc2cccnc2)cc1)NC1CS(=O)(=O)CC1N1CCCC1 |
| InChI | InChI=1S/C23H27N3O4S/c27-23(25-21-16-31(28,29)17-22(21)26-12-1-2-13-26)10-7-18-5-8-20(9-6-18)30-15-19-4-3-11-24-14-19/h3-11,14,21-22H,1-2,12-13,15-17H2,(H,25,27)/b10-7+ |
| InChIKey | HQHULFYSDYAMDV-JXMROGBWSA-N |
| XLogP | 2.05 |
| TPSA | 88.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 441.55 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|