C22H24N2O3 — CID 166282599
(E)-N-[(1S,5R,6R,7S)-7-hydroxy-6-bicyclo[3.2.0]heptanyl]-3-[4-(pyridin-3-ylmethoxy)phenyl]prop-2-enamide (PubChem CID 166282599) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is (E)-N-[(1S,5R,6R,7S)-7-hydroxy-6-bicyclo[3.2.0]heptanyl]-3-[4-(pyridin-3-ylmethoxy)phenyl]prop-2-enamide.
| Compound Name | (E)-N-[(1S,5R,6R,7S)-7-hydroxy-6-bicyclo[3.2.0]heptanyl]-3-[4-(pyridin-3-ylmethoxy)phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 166282599 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (E)-N-[(1S,5R,6R,7S)-7-hydroxy-6-bicyclo[3.2.0]heptanyl]-3-[4-(pyridin-3-ylmethoxy)phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(OCc2cccnc2)cc1)N[C@H]1[C@@H](O)[C@H]2CCC[C@H]21 |
| InChI | InChI=1S/C22H24N2O3/c25-20(24-21-18-4-1-5-19(18)22(21)26)11-8-15-6-9-17(10-7-15)27-14-16-3-2-12-23-13-16/h2-3,6-13,18-19,21-22,26H,1,4-5,14H2,(H,24,25)/b11-8+/t18-,19+,21-,22+/m1/s1 |
| InChIKey | OAWHSGFHHHAROA-HRCDLGQHSA-N |
| XLogP | 2.95 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|