C24H20N4O2S — CID 56532567
(E)-3-[4-(pyridin-3-ylmethoxy)phenyl]-N-[(4-pyridin-4-yl-1,3-thiazol-2-yl)methyl]prop-2-enamide (PubChem CID 56532567) has the molecular formula C24H20N4O2S and a molecular weight of 428.52 g/mol. Its IUPAC name is (E)-3-[4-(pyridin-3-ylmethoxy)phenyl]-N-[(4-pyridin-4-yl-1,3-thiazol-2-yl)methyl]prop-2-enamide.
| Compound Name | (E)-3-[4-(pyridin-3-ylmethoxy)phenyl]-N-[(4-pyridin-4-yl-1,3-thiazol-2-yl)methyl]prop-2-enamide |
|---|---|
| PubChem CID | 56532567 |
| Molecular Formula | C24H20N4O2S |
| Molecular Weight | 428.52 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | (E)-3-[4-(pyridin-3-ylmethoxy)phenyl]-N-[(4-pyridin-4-yl-1,3-thiazol-2-yl)methyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(OCc2cccnc2)cc1)NCc1nc(-c2ccncc2)cs1 |
| InChI | InChI=1S/C24H20N4O2S/c29-23(27-15-24-28-22(17-31-24)20-9-12-25-13-10-20)8-5-18-3-6-21(7-4-18)30-16-19-2-1-11-26-14-19/h1-14,17H,15-16H2,(H,27,29)/b8-5+ |
| InChIKey | NMRGCXFIWGLLKJ-VMPITWQZSA-N |
| XLogP | 4.51 |
| TPSA | 77.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.52 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|