C22H25N3O2 — CID 10316656
(E)-3-(4-hydroxyphenyl)-N-[(2R,3S)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]prop-2-enamide (PubChem CID 10316656) has the molecular formula C22H25N3O2 and a molecular weight of 363.46 g/mol. Its IUPAC name is (E)-3-(4-hydroxyphenyl)-N-[(2R,3S)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]prop-2-enamide.
| Compound Name | (E)-3-(4-hydroxyphenyl)-N-[(2R,3S)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 10316656 |
| Molecular Formula | C22H25N3O2 |
| Molecular Weight | 363.46 g/mol |
| Exact Mass | 363.19 |
| IUPAC Name | (E)-3-(4-hydroxyphenyl)-N-[(2R,3S)-2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(O)cc1)N[C@H]1C2CCN(CC2)[C@@H]1Cc1cccnc1 |
| InChI | InChI=1S/C22H25N3O2/c26-19-6-3-16(4-7-19)5-8-21(27)24-22-18-9-12-25(13-10-18)20(22)14-17-2-1-11-23-15-17/h1-8,11,15,18,20,22,26H,9-10,12-14H2,(H,24,27)/b8-5+/t20-,22+/m1/s1 |
| InChIKey | YVCCTXSCQDPZQH-CRZUHJALSA-N |
| XLogP | 2.62 |
| TPSA | 65.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.46 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|