C22H24BrN3O — CID 11718836
(E)-3-(3-bromophenyl)-N-[2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]prop-2-enamide (PubChem CID 11718836) has the molecular formula C22H24BrN3O and a molecular weight of 426.36 g/mol. Its IUPAC name is (E)-3-(3-bromophenyl)-N-[2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]prop-2-enamide.
| Compound Name | (E)-3-(3-bromophenyl)-N-[2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]prop-2-enamide |
|---|---|
| PubChem CID | 11718836 |
| Molecular Formula | C22H24BrN3O |
| Molecular Weight | 426.36 g/mol |
| Exact Mass | 425.11 |
| IUPAC Name | (E)-3-(3-bromophenyl)-N-[2-(pyridin-3-ylmethyl)-1-azabicyclo[2.2.2]octan-3-yl]prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc(Br)c1)NC1C2CCN(CC2)C1Cc1cccnc1 |
| InChI | InChI=1S/C22H24BrN3O/c23-19-5-1-3-16(13-19)6-7-21(27)25-22-18-8-11-26(12-9-18)20(22)14-17-4-2-10-24-15-17/h1-7,10,13,15,18,20,22H,8-9,11-12,14H2,(H,25,27)/b7-6+ |
| InChIKey | XFTSHKMQRBRWCJ-VOTSOKGWSA-N |
| XLogP | 3.68 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.36 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|