C24H22N2O4 — CID 39471203
ethyl 3-[[(E)-3-[4-(pyridin-3-ylmethoxy)phenyl]prop-2-enoyl]amino]benzoate (PubChem CID 39471203) has the molecular formula C24H22N2O4 and a molecular weight of 402.45 g/mol. Its IUPAC name is ethyl 3-[[(E)-3-[4-(pyridin-3-ylmethoxy)phenyl]prop-2-enoyl]amino]benzoate.
| Compound Name | ethyl 3-[[(E)-3-[4-(pyridin-3-ylmethoxy)phenyl]prop-2-enoyl]amino]benzoate |
|---|---|
| PubChem CID | 39471203 |
| Molecular Formula | C24H22N2O4 |
| Molecular Weight | 402.45 g/mol |
| Exact Mass | 402.16 |
| IUPAC Name | ethyl 3-[[(E)-3-[4-(pyridin-3-ylmethoxy)phenyl]prop-2-enoyl]amino]benzoate |
| SMILES | CCOC(=O)c1cccc(NC(=O)/C=C/c2ccc(OCc3cccnc3)cc2)c1 |
| InChI | InChI=1S/C24H22N2O4/c1-2-29-24(28)20-6-3-7-21(15-20)26-23(27)13-10-18-8-11-22(12-9-18)30-17-19-5-4-14-25-16-19/h3-16H,2,17H2,1H3,(H,26,27)/b13-10+ |
| InChIKey | GCESCQURBOFQIB-JLHYYAGUSA-N |
| XLogP | 4.49 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.45 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|