C22H17F2N3O3 — CID 56570754
2,4-difluoro-5-[[(E)-3-[4-(pyridin-3-ylmethoxy)phenyl]prop-2-enoyl]amino]benzamide (PubChem CID 56570754) has the molecular formula C22H17F2N3O3 and a molecular weight of 409.39 g/mol. Its IUPAC name is 2,4-difluoro-5-[[(E)-3-[4-(pyridin-3-ylmethoxy)phenyl]prop-2-enoyl]amino]benzamide.
| Compound Name | 2,4-difluoro-5-[[(E)-3-[4-(pyridin-3-ylmethoxy)phenyl]prop-2-enoyl]amino]benzamide |
|---|---|
| PubChem CID | 56570754 |
| Molecular Formula | C22H17F2N3O3 |
| Molecular Weight | 409.39 g/mol |
| Exact Mass | 409.12 |
| IUPAC Name | 2,4-difluoro-5-[[(E)-3-[4-(pyridin-3-ylmethoxy)phenyl]prop-2-enoyl]amino]benzamide |
| SMILES | NC(=O)c1cc(NC(=O)/C=C/c2ccc(OCc3cccnc3)cc2)c(F)cc1F |
| InChI | InChI=1S/C22H17F2N3O3/c23-18-11-19(24)20(10-17(18)22(25)29)27-21(28)8-5-14-3-6-16(7-4-14)30-13-15-2-1-9-26-12-15/h1-12H,13H2,(H2,25,29)(H,27,28)/b8-5+ |
| InChIKey | PGYDSZMLLPGLAY-VMPITWQZSA-N |
| XLogP | 3.69 |
| TPSA | 94.31 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.39 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|