C20H28F2N2O3 — CID 55980532
(E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-(2-methyl-3-piperidin-1-ylpropyl)prop-2-enamide (PubChem CID 55980532) has the molecular formula C20H28F2N2O3 and a molecular weight of 382.45 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-(2-methyl-3-piperidin-1-ylpropyl)prop-2-enamide.
| Compound Name | (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-(2-methyl-3-piperidin-1-ylpropyl)prop-2-enamide |
|---|---|
| PubChem CID | 55980532 |
| Molecular Formula | C20H28F2N2O3 |
| Molecular Weight | 382.45 g/mol |
| Exact Mass | 382.21 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-(2-methyl-3-piperidin-1-ylpropyl)prop-2-enamide |
| SMILES | COc1cccc(/C=C/C(=O)NCC(C)CN2CCCCC2)c1OC(F)F |
| InChI | InChI=1S/C20H28F2N2O3/c1-15(14-24-11-4-3-5-12-24)13-23-18(25)10-9-16-7-6-8-17(26-2)19(16)27-20(21)22/h6-10,15,20H,3-5,11-14H2,1-2H3,(H,23,25)/b10-9+ |
| InChIKey | KMWCDAPUWFXCSR-MDZDMXLPSA-N |
| XLogP | 3.55 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.45 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|