C23H24F2N2O4 — CID 55749846
(E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-[2-(2-oxopyrrolidin-1-yl)-1-phenylethyl]prop-2-enamide (PubChem CID 55749846) has the molecular formula C23H24F2N2O4 and a molecular weight of 430.45 g/mol. Its IUPAC name is (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-[2-(2-oxopyrrolidin-1-yl)-1-phenylethyl]prop-2-enamide.
| Compound Name | (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-[2-(2-oxopyrrolidin-1-yl)-1-phenylethyl]prop-2-enamide |
|---|---|
| PubChem CID | 55749846 |
| Molecular Formula | C23H24F2N2O4 |
| Molecular Weight | 430.45 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | (E)-3-[2-(difluoromethoxy)-3-methoxyphenyl]-N-[2-(2-oxopyrrolidin-1-yl)-1-phenylethyl]prop-2-enamide |
| SMILES | COc1cccc(/C=C/C(=O)NC(CN2CCCC2=O)c2ccccc2)c1OC(F)F |
| InChI | InChI=1S/C23H24F2N2O4/c1-30-19-10-5-9-17(22(19)31-23(24)25)12-13-20(28)26-18(16-7-3-2-4-8-16)15-27-14-6-11-21(27)29/h2-5,7-10,12-13,18,23H,6,11,14-15H2,1H3,(H,26,28)/b13-12+ |
| InChIKey | XQIIQXPPYUXMMF-OUKQBFOZSA-N |
| XLogP | 3.79 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.45 |
| LogP ≤ 5 | 3.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|